C19H31N5O5S — CID 3702616
methyl 2-[[5-(diaminomethylideneamino)-2-[(4-methylphenyl)sulfonylamino]pentanoyl]amino]-3-methylbutanoate (PubChem CID 3702616) has the molecular formula C19H31N5O5S and a molecular weight of 441.55 g/mol. Its IUPAC name is methyl 2-[[5-(diaminomethylideneamino)-2-[(4-methylphenyl)sulfonylamino]pentanoyl]amino]-3-methylbutanoate.
| Compound Name | methyl 2-[[5-(diaminomethylideneamino)-2-[(4-methylphenyl)sulfonylamino]pentanoyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 3702616 |
| Molecular Formula | C19H31N5O5S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | methyl 2-[[5-(diaminomethylideneamino)-2-[(4-methylphenyl)sulfonylamino]pentanoyl]amino]-3-methylbutanoate |
| SMILES | COC(=O)C(NC(=O)C(CCCN=C(N)N)NS(=O)(=O)c1ccc(C)cc1)C(C)C |
| InChI | InChI=1S/C19H31N5O5S/c1-12(2)16(18(26)29-4)23-17(25)15(6-5-11-22-19(20)21)24-30(27,28)14-9-7-13(3)8-10-14/h7-10,12,15-16,24H,5-6,11H2,1-4H3,(H,23,25)(H4,20,21,22) |
| InChIKey | IMIDYOIXFVGFJC-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 165.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|