C28H44N4O7S2 — CID 117068293
4-methylbenzenesulfonic acid;octyl (2S)-5-(diaminomethylideneamino)-2-[(4-methylphenyl)sulfonylamino]pentanoate (PubChem CID 117068293) has the molecular formula C28H44N4O7S2 and a molecular weight of 612.82 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;octyl (2S)-5-(diaminomethylideneamino)-2-[(4-methylphenyl)sulfonylamino]pentanoate.
| Compound Name | 4-methylbenzenesulfonic acid;octyl (2S)-5-(diaminomethylideneamino)-2-[(4-methylphenyl)sulfonylamino]pentanoate |
|---|---|
| PubChem CID | 117068293 |
| Molecular Formula | C28H44N4O7S2 |
| Molecular Weight | 612.82 g/mol |
| Exact Mass | 612.27 |
| IUPAC Name | 4-methylbenzenesulfonic acid;octyl (2S)-5-(diaminomethylideneamino)-2-[(4-methylphenyl)sulfonylamino]pentanoate |
| SMILES | CCCCCCCCOC(=O)[C@H](CCCN=C(N)N)NS(=O)(=O)c1ccc(C)cc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C21H36N4O4S.C7H8O3S/c1-3-4-5-6-7-8-16-29-20(26)19(10-9-15-24-21(22)23)25-30(27,28)18-13-11-17(2)12-14-18;1-6-2-4-7(5-3-6)11(8,9)10/h11-14,19,25H,3-10,15-16H2,1-2H3,(H4,22,23,24);2-5H,1H3,(H,8,9,10)/t19-;/m0./s1 |
| InChIKey | CAILLGOGHAKALV-FYZYNONXSA-N |
| XLogP | 3.84 |
| TPSA | 191.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.82 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|