C20H25N5O6S — CID 175919249
benzyl (2S)-5-[[amino(nitramido)methylidene]amino]-2-[(4-methylphenyl)sulfonylamino]pentanoate (PubChem CID 175919249) has the molecular formula C20H25N5O6S and a molecular weight of 463.52 g/mol. Its IUPAC name is benzyl (2S)-5-[[amino(nitramido)methylidene]amino]-2-[(4-methylphenyl)sulfonylamino]pentanoate.
| Compound Name | benzyl (2S)-5-[[amino(nitramido)methylidene]amino]-2-[(4-methylphenyl)sulfonylamino]pentanoate |
|---|---|
| PubChem CID | 175919249 |
| Molecular Formula | C20H25N5O6S |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | benzyl (2S)-5-[[amino(nitramido)methylidene]amino]-2-[(4-methylphenyl)sulfonylamino]pentanoate |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](CCC/N=C(\N)N[N+](=O)[O-])C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H25N5O6S/c1-15-9-11-17(12-10-15)32(29,30)24-18(8-5-13-22-20(21)23-25(27)28)19(26)31-14-16-6-3-2-4-7-16/h2-4,6-7,9-12,18,24H,5,8,13-14H2,1H3,(H3,21,22,23)/t18-/m0/s1 |
| InChIKey | SWMWVJGAGHPTKU-SFHVURJKSA-N |
| XLogP | 1.26 |
| TPSA | 166.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|