C20H33N5O6S — CID 52993898
(2R)-5-(diaminomethylideneamino)-2-[[1-[(4-methylphenyl)sulfonylamino]cyclohexanecarbonyl]amino]pentanoic acid;hydrate (PubChem CID 52993898) has the molecular formula C20H33N5O6S and a molecular weight of 471.58 g/mol. Its IUPAC name is (2R)-5-(diaminomethylideneamino)-2-[[1-[(4-methylphenyl)sulfonylamino]cyclohexanecarbonyl]amino]pentanoic acid;hydrate.
| Compound Name | (2R)-5-(diaminomethylideneamino)-2-[[1-[(4-methylphenyl)sulfonylamino]cyclohexanecarbonyl]amino]pentanoic acid;hydrate |
|---|---|
| PubChem CID | 52993898 |
| Molecular Formula | C20H33N5O6S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | (2R)-5-(diaminomethylideneamino)-2-[[1-[(4-methylphenyl)sulfonylamino]cyclohexanecarbonyl]amino]pentanoic acid;hydrate |
| SMILES | Cc1ccc(S(=O)(=O)NC2(C(=O)N[C@H](CCCN=C(N)N)C(=O)O)CCCCC2)cc1.O |
| InChI | InChI=1S/C20H31N5O5S.H2O/c1-14-7-9-15(10-8-14)31(29,30)25-20(11-3-2-4-12-20)18(28)24-16(17(26)27)6-5-13-23-19(21)22;/h7-10,16,25H,2-6,11-13H2,1H3,(H,24,28)(H,26,27)(H4,21,22,23);1H2/t16-;/m1./s1 |
| InChIKey | SDQZVCDLYVTAJZ-PKLMIRHRSA-N |
| XLogP | -0.23 |
| TPSA | 208.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|