C14H20N4O5S — CID 141340289
(2S)-5-(diaminomethylideneamino)-2-(2,3-dihydro-1-benzofuran-5-ylsulfonylamino)pentanoic acid (PubChem CID 141340289) has the molecular formula C14H20N4O5S and a molecular weight of 356.40 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-(2,3-dihydro-1-benzofuran-5-ylsulfonylamino)pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-(2,3-dihydro-1-benzofuran-5-ylsulfonylamino)pentanoic acid |
|---|---|
| PubChem CID | 141340289 |
| Molecular Formula | C14H20N4O5S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-(2,3-dihydro-1-benzofuran-5-ylsulfonylamino)pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](NS(=O)(=O)c1ccc2c(c1)CCO2)C(=O)O |
| InChI | InChI=1S/C14H20N4O5S/c15-14(16)17-6-1-2-11(13(19)20)18-24(21,22)10-3-4-12-9(8-10)5-7-23-12/h3-4,8,11,18H,1-2,5-7H2,(H,19,20)(H4,15,16,17)/t11-/m0/s1 |
| InChIKey | KTGHUNDIYPDZBR-NSHDSACASA-N |
| XLogP | -0.59 |
| TPSA | 157.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|