C16H24N4O5S — CID 141152065
(2S)-5-(diaminomethylideneamino)-2-[3,4-dihydro-2H-chromen-6-ylsulfonyl(methyl)amino]pentanoic acid (PubChem CID 141152065) has the molecular formula C16H24N4O5S and a molecular weight of 384.46 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[3,4-dihydro-2H-chromen-6-ylsulfonyl(methyl)amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[3,4-dihydro-2H-chromen-6-ylsulfonyl(methyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 141152065 |
| Molecular Formula | C16H24N4O5S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[3,4-dihydro-2H-chromen-6-ylsulfonyl(methyl)amino]pentanoic acid |
| SMILES | CN([C@@H](CCCN=C(N)N)C(=O)O)S(=O)(=O)c1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C16H24N4O5S/c1-20(13(15(21)22)5-2-8-19-16(17)18)26(23,24)12-6-7-14-11(10-12)4-3-9-25-14/h6-7,10,13H,2-5,8-9H2,1H3,(H,21,22)(H4,17,18,19)/t13-/m0/s1 |
| InChIKey | SGCDMOWXMWGESH-ZDUSSCGKSA-N |
| XLogP | 0.14 |
| TPSA | 148.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|