C19H30N4O5S — CID 68992122
(2S)-5-(diaminomethylideneamino)-2-[2,3-dihydro-1-benzofuran-5-ylsulfonyl(methyl)amino]-2,3,3,4-tetramethylpentanoic acid (PubChem CID 68992122) has the molecular formula C19H30N4O5S and a molecular weight of 426.54 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[2,3-dihydro-1-benzofuran-5-ylsulfonyl(methyl)amino]-2,3,3,4-tetramethylpentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[2,3-dihydro-1-benzofuran-5-ylsulfonyl(methyl)amino]-2,3,3,4-tetramethylpentanoic acid |
|---|---|
| PubChem CID | 68992122 |
| Molecular Formula | C19H30N4O5S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[2,3-dihydro-1-benzofuran-5-ylsulfonyl(methyl)amino]-2,3,3,4-tetramethylpentanoic acid |
| SMILES | CC(CN=C(N)N)C(C)(C)[C@@](C)(C(=O)O)N(C)S(=O)(=O)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C19H30N4O5S/c1-12(11-22-17(20)21)18(2,3)19(4,16(24)25)23(5)29(26,27)14-6-7-15-13(10-14)8-9-28-15/h6-7,10,12H,8-9,11H2,1-5H3,(H,24,25)(H4,20,21,22)/t12?,19-/m1/s1 |
| InChIKey | DZCJKXBFQJXSPY-FKWGRNQDSA-N |
| XLogP | 1.02 |
| TPSA | 148.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|