C14H19NO6S — CID 3796406
2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanoic acid (PubChem CID 3796406) has the molecular formula C14H19NO6S and a molecular weight of 329.37 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanoic acid.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanoic acid |
|---|---|
| PubChem CID | 3796406 |
| Molecular Formula | C14H19NO6S |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanoic acid |
| SMILES | CCCCC(NS(=O)(=O)c1ccc2c(c1)OCCO2)C(=O)O |
| InChI | InChI=1S/C14H19NO6S/c1-2-3-4-11(14(16)17)15-22(18,19)10-5-6-12-13(9-10)21-8-7-20-12/h5-6,9,11,15H,2-4,7-8H2,1H3,(H,16,17) |
| InChIKey | XMKXORPXRBAWHN-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |