C16H25NO4S — CID 35396653
N-[(2S)-2-ethylhexyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide (PubChem CID 35396653) has the molecular formula C16H25NO4S and a molecular weight of 327.45 g/mol. Its IUPAC name is N-[(2S)-2-ethylhexyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide.
| Compound Name | N-[(2S)-2-ethylhexyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
|---|---|
| PubChem CID | 35396653 |
| Molecular Formula | C16H25NO4S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | N-[(2S)-2-ethylhexyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| SMILES | CCCC[C@H](CC)CNS(=O)(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C16H25NO4S/c1-3-5-6-13(4-2)12-17-22(18,19)14-7-8-15-16(11-14)21-10-9-20-15/h7-8,11,13,17H,3-6,9-10,12H2,1-2H3/t13-/m0/s1 |
| InChIKey | NLPZTQSMGZHNJQ-ZDUSSCGKSA-N |
| XLogP | 2.95 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |