C15H25NO4S2 — CID 42955218
N-(2-ethylhexyl)-3-methylsulfonylbenzenesulfonamide (PubChem CID 42955218) has the molecular formula C15H25NO4S2 and a molecular weight of 347.50 g/mol. Its IUPAC name is N-(2-ethylhexyl)-3-methylsulfonylbenzenesulfonamide.
| Compound Name | N-(2-ethylhexyl)-3-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 42955218 |
| Molecular Formula | C15H25NO4S2 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | N-(2-ethylhexyl)-3-methylsulfonylbenzenesulfonamide |
| SMILES | CCCCC(CC)CNS(=O)(=O)c1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C15H25NO4S2/c1-4-6-8-13(5-2)12-16-22(19,20)15-10-7-9-14(11-15)21(3,17)18/h7,9-11,13,16H,4-6,8,12H2,1-3H3 |
| InChIKey | LXUZASVHZZDBMY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |