C15H26N2O4S2 — CID 20769759
N-(2-ethylhexyl)-4-(methanesulfonamido)benzenesulfonamide (PubChem CID 20769759) has the molecular formula C15H26N2O4S2 and a molecular weight of 362.52 g/mol. Its IUPAC name is N-(2-ethylhexyl)-4-(methanesulfonamido)benzenesulfonamide.
| Compound Name | N-(2-ethylhexyl)-4-(methanesulfonamido)benzenesulfonamide |
|---|---|
| PubChem CID | 20769759 |
| Molecular Formula | C15H26N2O4S2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | N-(2-ethylhexyl)-4-(methanesulfonamido)benzenesulfonamide |
| SMILES | CCCCC(CC)CNS(=O)(=O)c1ccc(NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C15H26N2O4S2/c1-4-6-7-13(5-2)12-16-23(20,21)15-10-8-14(9-11-15)17-22(3,18)19/h8-11,13,16-17H,4-7,12H2,1-3H3 |
| InChIKey | GEAYJSSRUPVTKO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |