C10H15NO5S — CID 120968679
2-(furan-3-ylsulfonylamino)hexanoic acid (PubChem CID 120968679) has the molecular formula C10H15NO5S and a molecular weight of 261.30 g/mol. Its IUPAC name is 2-(furan-3-ylsulfonylamino)hexanoic acid.
| Compound Name | 2-(furan-3-ylsulfonylamino)hexanoic acid |
|---|---|
| PubChem CID | 120968679 |
| Molecular Formula | C10H15NO5S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 2-(furan-3-ylsulfonylamino)hexanoic acid |
| SMILES | CCCCC(NS(=O)(=O)c1ccoc1)C(=O)O |
| InChI | InChI=1S/C10H15NO5S/c1-2-3-4-9(10(12)13)11-17(14,15)8-5-6-16-7-8/h5-7,9,11H,2-4H2,1H3,(H,12,13) |
| InChIKey | RTRYFLKZKGYQLU-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |