C23H29N5O7S2 — CID 87599423
(2R)-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]-2-[(4-but-2-ynoxyphenyl)sulfonylamino]-N-hydroxypentanamide (PubChem CID 87599423) has the molecular formula C23H29N5O7S2 and a molecular weight of 551.65 g/mol. Its IUPAC name is (2R)-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]-2-[(4-but-2-ynoxyphenyl)sulfonylamino]-N-hydroxypentanamide.
| Compound Name | (2R)-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]-2-[(4-but-2-ynoxyphenyl)sulfonylamino]-N-hydroxypentanamide |
|---|---|
| PubChem CID | 87599423 |
| Molecular Formula | C23H29N5O7S2 |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.15 |
| IUPAC Name | (2R)-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]-2-[(4-but-2-ynoxyphenyl)sulfonylamino]-N-hydroxypentanamide |
| SMILES | CC#CCOc1ccc(S(=O)(=O)N[C@H](CCC/N=C(\N)NS(=O)(=O)c2ccc(C)cc2)C(=O)NO)cc1 |
| InChI | InChI=1S/C23H29N5O7S2/c1-3-4-16-35-18-9-13-20(14-10-18)36(31,32)27-21(22(29)26-30)6-5-15-25-23(24)28-37(33,34)19-11-7-17(2)8-12-19/h7-14,21,27,30H,5-6,15-16H2,1-2H3,(H,26,29)(H3,24,25,28)/t21-/m1/s1 |
| InChIKey | MBDOLNLYJOZZPG-OAQYLSRUSA-N |
| XLogP | 0.62 |
| TPSA | 189.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|