C24H27Cl2N3O6S — CID 22644728
2-[(4-but-2-ynoxyphenyl)sulfonylamino]-6-[[2-(3,4-dichlorophenyl)acetyl]amino]-N-hydroxyhexanamide (PubChem CID 22644728) has the molecular formula C24H27Cl2N3O6S and a molecular weight of 556.47 g/mol. Its IUPAC name is 2-[(4-but-2-ynoxyphenyl)sulfonylamino]-6-[[2-(3,4-dichlorophenyl)acetyl]amino]-N-hydroxyhexanamide.
| Compound Name | 2-[(4-but-2-ynoxyphenyl)sulfonylamino]-6-[[2-(3,4-dichlorophenyl)acetyl]amino]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 22644728 |
| Molecular Formula | C24H27Cl2N3O6S |
| Molecular Weight | 556.47 g/mol |
| Exact Mass | 555.10 |
| IUPAC Name | 2-[(4-but-2-ynoxyphenyl)sulfonylamino]-6-[[2-(3,4-dichlorophenyl)acetyl]amino]-N-hydroxyhexanamide |
| SMILES | CC#CCOc1ccc(S(=O)(=O)NC(CCCCNC(=O)Cc2ccc(Cl)c(Cl)c2)C(=O)NO)cc1 |
| InChI | InChI=1S/C24H27Cl2N3O6S/c1-2-3-14-35-18-8-10-19(11-9-18)36(33,34)29-22(24(31)28-32)6-4-5-13-27-23(30)16-17-7-12-20(25)21(26)15-17/h7-12,15,22,29,32H,4-6,13-14,16H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | WELRUUGEEOLIIT-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|