C26H29N3O5S — CID 10300346
2-(4-but-2-ynoxyphenyl)sulfinyl-N-hydroxy-6-[[2-(1H-indol-3-yl)acetyl]amino]hexanamide (PubChem CID 10300346) has the molecular formula C26H29N3O5S and a molecular weight of 495.60 g/mol. Its IUPAC name is 2-(4-but-2-ynoxyphenyl)sulfinyl-N-hydroxy-6-[[2-(1H-indol-3-yl)acetyl]amino]hexanamide.
| Compound Name | 2-(4-but-2-ynoxyphenyl)sulfinyl-N-hydroxy-6-[[2-(1H-indol-3-yl)acetyl]amino]hexanamide |
|---|---|
| PubChem CID | 10300346 |
| Molecular Formula | C26H29N3O5S |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | 2-(4-but-2-ynoxyphenyl)sulfinyl-N-hydroxy-6-[[2-(1H-indol-3-yl)acetyl]amino]hexanamide |
| SMILES | CC#CCOc1ccc(S(=O)C(CCCCNC(=O)Cc2c[nH]c3ccccc23)C(=O)NO)cc1 |
| InChI | InChI=1S/C26H29N3O5S/c1-2-3-16-34-20-11-13-21(14-12-20)35(33)24(26(31)29-32)10-6-7-15-27-25(30)17-19-18-28-23-9-5-4-8-22(19)23/h4-5,8-9,11-14,18,24,28,32H,6-7,10,15-17H2,1H3,(H,27,30)(H,29,31) |
| InChIKey | BMLZCPWNCNXXRV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|