C30H30N2O6S — CID 10209315
N-[5-(4-but-2-ynoxyphenyl)sulfinyl-6-(hydroxyamino)-6-oxohexyl]-9H-xanthene-9-carboxamide (PubChem CID 10209315) has the molecular formula C30H30N2O6S and a molecular weight of 546.65 g/mol. Its IUPAC name is N-[5-(4-but-2-ynoxyphenyl)sulfinyl-6-(hydroxyamino)-6-oxohexyl]-9H-xanthene-9-carboxamide.
| Compound Name | N-[5-(4-but-2-ynoxyphenyl)sulfinyl-6-(hydroxyamino)-6-oxohexyl]-9H-xanthene-9-carboxamide |
|---|---|
| PubChem CID | 10209315 |
| Molecular Formula | C30H30N2O6S |
| Molecular Weight | 546.65 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | N-[5-(4-but-2-ynoxyphenyl)sulfinyl-6-(hydroxyamino)-6-oxohexyl]-9H-xanthene-9-carboxamide |
| SMILES | CC#CCOc1ccc(S(=O)C(CCCCNC(=O)C2c3ccccc3Oc3ccccc32)C(=O)NO)cc1 |
| InChI | InChI=1S/C30H30N2O6S/c1-2-3-20-37-21-15-17-22(18-16-21)39(36)27(29(33)32-35)14-8-9-19-31-30(34)28-23-10-4-6-12-25(23)38-26-13-7-5-11-24(26)28/h4-7,10-13,15-18,27-28,35H,8-9,14,19-20H2,1H3,(H,31,34)(H,32,33) |
| InChIKey | GLSHWLDUUXCWDS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.65 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|