C22H26N4O3 — CID 142009832
N-[(5S)-6-amino-5-(1-aminoethylideneamino)-6-oxohexyl]-9H-xanthene-9-carboxamide (PubChem CID 142009832) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is N-[(5S)-6-amino-5-(1-aminoethylideneamino)-6-oxohexyl]-9H-xanthene-9-carboxamide.
| Compound Name | N-[(5S)-6-amino-5-(1-aminoethylideneamino)-6-oxohexyl]-9H-xanthene-9-carboxamide |
|---|---|
| PubChem CID | 142009832 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | N-[(5S)-6-amino-5-(1-aminoethylideneamino)-6-oxohexyl]-9H-xanthene-9-carboxamide |
| SMILES | C/C(N)=N\[C@@H](CCCCNC(=O)C1c2ccccc2Oc2ccccc21)C(N)=O |
| InChI | InChI=1S/C22H26N4O3/c1-14(23)26-17(21(24)27)10-6-7-13-25-22(28)20-15-8-2-4-11-18(15)29-19-12-5-3-9-16(19)20/h2-5,8-9,11-12,17,20H,6-7,10,13H2,1H3,(H2,23,26)(H2,24,27)(H,25,28)/t17-/m0/s1 |
| InChIKey | GOQMEEUHRNWTPR-KRWDZBQOSA-N |
| XLogP | 2.44 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|