C30H33N3O8S — CID 86604347
(2S)-2-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-6-(9H-xanthene-9-carbonylamino)hexanoic acid (PubChem CID 86604347) has the molecular formula C30H33N3O8S and a molecular weight of 595.67 g/mol. Its IUPAC name is (2S)-2-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-6-(9H-xanthene-9-carbonylamino)hexanoic acid.
| Compound Name | (2S)-2-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-6-(9H-xanthene-9-carbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 86604347 |
| Molecular Formula | C30H33N3O8S |
| Molecular Weight | 595.67 g/mol |
| Exact Mass | 595.20 |
| IUPAC Name | (2S)-2-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-6-(9H-xanthene-9-carbonylamino)hexanoic acid |
| SMILES | CC(C)CN([C@@H](CCCCNC(=O)C1c2ccccc2Oc2ccccc21)C(=O)O)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H33N3O8S/c1-20(2)19-32(42(39,40)22-16-14-21(15-17-22)33(37)38)25(30(35)36)11-7-8-18-31-29(34)28-23-9-3-5-12-26(23)41-27-13-6-4-10-24(27)28/h3-6,9-10,12-17,20,25,28H,7-8,11,18-19H2,1-2H3,(H,31,34)(H,35,36)/t25-/m0/s1 |
| InChIKey | PRHYBBRLBNLONX-VWLOTQADSA-N |
| XLogP | 4.92 |
| TPSA | 156.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.67 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|