C24H33N3O5S2 — CID 58624308
(2S)-2-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-[(2-phenylsulfanylacetyl)amino]hexanoic acid (PubChem CID 58624308) has the molecular formula C24H33N3O5S2 and a molecular weight of 507.68 g/mol. Its IUPAC name is (2S)-2-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-[(2-phenylsulfanylacetyl)amino]hexanoic acid.
| Compound Name | (2S)-2-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-[(2-phenylsulfanylacetyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 58624308 |
| Molecular Formula | C24H33N3O5S2 |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | (2S)-2-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-[(2-phenylsulfanylacetyl)amino]hexanoic acid |
| SMILES | CC(C)CN([C@@H](CCCCNC(=O)CSc1ccccc1)C(=O)O)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C24H33N3O5S2/c1-18(2)16-27(34(31,32)21-13-11-19(25)12-14-21)22(24(29)30)10-6-7-15-26-23(28)17-33-20-8-4-3-5-9-20/h3-5,8-9,11-14,18,22H,6-7,10,15-17,25H2,1-2H3,(H,26,28)(H,29,30)/t22-/m0/s1 |
| InChIKey | LCSZXYDUXHQDSV-QFIPXVFZSA-N |
| XLogP | 3.45 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|