C24H33N3O6S2 — CID 142084710
N-[(5S)-6-hydroxy-5-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]hexyl]-2-phenylsulfanylacetamide (PubChem CID 142084710) has the molecular formula C24H33N3O6S2 and a molecular weight of 523.68 g/mol. Its IUPAC name is N-[(5S)-6-hydroxy-5-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]hexyl]-2-phenylsulfanylacetamide.
| Compound Name | N-[(5S)-6-hydroxy-5-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]hexyl]-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 142084710 |
| Molecular Formula | C24H33N3O6S2 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | N-[(5S)-6-hydroxy-5-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]hexyl]-2-phenylsulfanylacetamide |
| SMILES | CC(C)CN([C@H](CO)CCCCNC(=O)CSc1ccccc1)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H33N3O6S2/c1-19(2)16-26(35(32,33)23-13-11-20(12-14-23)27(30)31)21(17-28)8-6-7-15-25-24(29)18-34-22-9-4-3-5-10-22/h3-5,9-14,19,21,28H,6-8,15-18H2,1-2H3,(H,25,29)/t21-/m0/s1 |
| InChIKey | WEELPLSVWQPIJT-NRFANRHFSA-N |
| XLogP | 3.68 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|