C35H48N4O5S — CID 89047368
(2S)-N-[(5S)-5-[[4-(aminomethyl)phenyl]sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]-2-(1-methoxyethenylamino)-3,3-diphenylpropanamide (PubChem CID 89047368) has the molecular formula C35H48N4O5S and a molecular weight of 636.86 g/mol. Its IUPAC name is (2S)-N-[(5S)-5-[[4-(aminomethyl)phenyl]sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]-2-(1-methoxyethenylamino)-3,3-diphenylpropanamide.
| Compound Name | (2S)-N-[(5S)-5-[[4-(aminomethyl)phenyl]sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]-2-(1-methoxyethenylamino)-3,3-diphenylpropanamide |
|---|---|
| PubChem CID | 89047368 |
| Molecular Formula | C35H48N4O5S |
| Molecular Weight | 636.86 g/mol |
| Exact Mass | 636.33 |
| IUPAC Name | (2S)-N-[(5S)-5-[[4-(aminomethyl)phenyl]sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]-2-(1-methoxyethenylamino)-3,3-diphenylpropanamide |
| SMILES | C=C(N[C@H](C(=O)NCCCC[C@@H](CO)N(CC(C)C)S(=O)(=O)c1ccc(CN)cc1)C(c1ccccc1)c1ccccc1)OC |
| InChI | InChI=1S/C35H48N4O5S/c1-26(2)24-39(45(42,43)32-20-18-28(23-36)19-21-32)31(25-40)17-11-12-22-37-35(41)34(38-27(3)44-4)33(29-13-7-5-8-14-29)30-15-9-6-10-16-30/h5-10,13-16,18-21,26,31,33-34,38,40H,3,11-12,17,22-25,36H2,1-2,4H3,(H,37,41)/t31-,34-/m0/s1 |
| InChIKey | FMTSHWIDCDMQLZ-VBTAUBHQSA-N |
| XLogP | 4.35 |
| TPSA | 133.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.86 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|