C38H52N4O5S — CID 513998
N-[(2S)-1-[[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]cyclohexanecarboxamide (PubChem CID 513998) has the molecular formula C38H52N4O5S and a molecular weight of 676.92 g/mol. Its IUPAC name is N-[(2S)-1-[[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]cyclohexanecarboxamide.
| Compound Name | N-[(2S)-1-[[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 513998 |
| Molecular Formula | C38H52N4O5S |
| Molecular Weight | 676.92 g/mol |
| Exact Mass | 676.37 |
| IUPAC Name | N-[(2S)-1-[[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]cyclohexanecarboxamide |
| SMILES | CC(C)CN([C@H](CO)CCCCNC(=O)[C@@H](NC(=O)C1CCCCC1)C(c1ccccc1)c1ccccc1)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C38H52N4O5S/c1-28(2)26-42(48(46,47)34-23-21-32(39)22-24-34)33(27-43)20-12-13-25-40-38(45)36(41-37(44)31-18-10-5-11-19-31)35(29-14-6-3-7-15-29)30-16-8-4-9-17-30/h3-4,6-9,14-17,21-24,28,31,33,35-36,43H,5,10-13,18-20,25-27,39H2,1-2H3,(H,40,45)(H,41,44)/t33-,36-/m0/s1 |
| InChIKey | WGTZQWMEHWJKHH-JUKUECOXSA-N |
| XLogP | 5.46 |
| TPSA | 141.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.92 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|