C28H47N3O6S — CID 157191193
methyl (3R)-4-[[(5R)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-3-(cyclohexylmethyl)-4-oxobutanoate (PubChem CID 157191193) has the molecular formula C28H47N3O6S and a molecular weight of 553.77 g/mol. Its IUPAC name is methyl (3R)-4-[[(5R)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-3-(cyclohexylmethyl)-4-oxobutanoate.
| Compound Name | methyl (3R)-4-[[(5R)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-3-(cyclohexylmethyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 157191193 |
| Molecular Formula | C28H47N3O6S |
| Molecular Weight | 553.77 g/mol |
| Exact Mass | 553.32 |
| IUPAC Name | methyl (3R)-4-[[(5R)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-3-(cyclohexylmethyl)-4-oxobutanoate |
| SMILES | COC(=O)C[C@@H](CC1CCCCC1)C(=O)NCCCC[C@H](CO)N(CC(C)C)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C28H47N3O6S/c1-21(2)19-31(38(35,36)26-14-12-24(29)13-15-26)25(20-32)11-7-8-16-30-28(34)23(18-27(33)37-3)17-22-9-5-4-6-10-22/h12-15,21-23,25,32H,4-11,16-20,29H2,1-3H3,(H,30,34)/t23-,25-/m1/s1 |
| InChIKey | APSHNUJDAQGELF-ILBGXUMGSA-N |
| XLogP | 3.71 |
| TPSA | 139.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.77 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|