C34H46N4O7S — CID 67531756
methyl N-[(2S)-1-[[5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-3-[2-(4-methoxyphenyl)phenyl]-1-oxopropan-2-yl]carbamate (PubChem CID 67531756) has the molecular formula C34H46N4O7S and a molecular weight of 654.83 g/mol. Its IUPAC name is methyl N-[(2S)-1-[[5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-3-[2-(4-methoxyphenyl)phenyl]-1-oxopropan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-1-[[5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-3-[2-(4-methoxyphenyl)phenyl]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 67531756 |
| Molecular Formula | C34H46N4O7S |
| Molecular Weight | 654.83 g/mol |
| Exact Mass | 654.31 |
| IUPAC Name | methyl N-[(2S)-1-[[5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-3-[2-(4-methoxyphenyl)phenyl]-1-oxopropan-2-yl]carbamate |
| SMILES | COC(=O)N[C@@H](Cc1ccccc1-c1ccc(OC)cc1)C(=O)NCCCCC(CO)N(CC(C)C)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C34H46N4O7S/c1-24(2)22-38(46(42,43)30-18-14-27(35)15-19-30)28(23-39)10-7-8-20-36-33(40)32(37-34(41)45-4)21-26-9-5-6-11-31(26)25-12-16-29(44-3)17-13-25/h5-6,9,11-19,24,28,32,39H,7-8,10,20-23,35H2,1-4H3,(H,36,40)(H,37,41)/t28?,32-/m0/s1 |
| InChIKey | XBWHEMLSXDNCJI-YYMSGCCCSA-N |
| XLogP | 4.21 |
| TPSA | 160.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.83 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|