C37H46N4O6S — CID 513927
(2S)-N-[(4S)-4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-5-hydroxypentyl]-2-[[2-(4-methoxyphenyl)acetyl]amino]-3-naphthalen-1-ylpropanamide (PubChem CID 513927) has the molecular formula C37H46N4O6S and a molecular weight of 674.86 g/mol. Its IUPAC name is (2S)-N-[(4S)-4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-5-hydroxypentyl]-2-[[2-(4-methoxyphenyl)acetyl]amino]-3-naphthalen-1-ylpropanamide.
| Compound Name | (2S)-N-[(4S)-4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-5-hydroxypentyl]-2-[[2-(4-methoxyphenyl)acetyl]amino]-3-naphthalen-1-ylpropanamide |
|---|---|
| PubChem CID | 513927 |
| Molecular Formula | C37H46N4O6S |
| Molecular Weight | 674.86 g/mol |
| Exact Mass | 674.31 |
| IUPAC Name | (2S)-N-[(4S)-4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-5-hydroxypentyl]-2-[[2-(4-methoxyphenyl)acetyl]amino]-3-naphthalen-1-ylpropanamide |
| SMILES | COc1ccc(CC(=O)N[C@@H](Cc2cccc3ccccc23)C(=O)NCCC[C@@H](CO)N(CC(C)C)S(=O)(=O)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C37H46N4O6S/c1-26(2)24-41(48(45,46)33-19-15-30(38)16-20-33)31(25-42)11-7-21-39-37(44)35(23-29-10-6-9-28-8-4-5-12-34(28)29)40-36(43)22-27-13-17-32(47-3)18-14-27/h4-6,8-10,12-20,26,31,35,42H,7,11,21-25,38H2,1-3H3,(H,39,44)(H,40,43)/t31-,35-/m0/s1 |
| InChIKey | RJSIOBPBENPMRZ-ZJJOJAIXSA-N |
| XLogP | 4.30 |
| TPSA | 151.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.86 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|