C33H42N4O6S3 — CID 24997987
(2S)-N-[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]-3-naphthalen-2-yl-2-(thiophen-2-ylsulfonylamino)propanamide (PubChem CID 24997987) has the molecular formula C33H42N4O6S3 and a molecular weight of 686.92 g/mol. Its IUPAC name is (2S)-N-[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]-3-naphthalen-2-yl-2-(thiophen-2-ylsulfonylamino)propanamide.
| Compound Name | (2S)-N-[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]-3-naphthalen-2-yl-2-(thiophen-2-ylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 24997987 |
| Molecular Formula | C33H42N4O6S3 |
| Molecular Weight | 686.92 g/mol |
| Exact Mass | 686.23 |
| IUPAC Name | (2S)-N-[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]-3-naphthalen-2-yl-2-(thiophen-2-ylsulfonylamino)propanamide |
| SMILES | CC(C)CN([C@H](CO)CCCCNC(=O)[C@H](Cc1ccc2ccccc2c1)NS(=O)(=O)c1cccs1)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C33H42N4O6S3/c1-24(2)22-37(46(42,43)30-16-14-28(34)15-17-30)29(23-38)10-5-6-18-35-33(39)31(36-45(40,41)32-11-7-19-44-32)21-25-12-13-26-8-3-4-9-27(26)20-25/h3-4,7-9,11-17,19-20,24,29,31,36,38H,5-6,10,18,21-23,34H2,1-2H3,(H,35,39)/t29-,31-/m0/s1 |
| InChIKey | AWPZKRBLMTYKMI-SMCANUKXSA-N |
| XLogP | 4.37 |
| TPSA | 158.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.92 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|