C31H39F3N4O6S — CID 68649572
2,2,2-trifluoroethyl N-[1-[[4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-5-hydroxypentyl]amino]-3-naphthalen-1-yl-1-oxopropan-2-yl]carbamate (PubChem CID 68649572) has the molecular formula C31H39F3N4O6S and a molecular weight of 652.74 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-[1-[[4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-5-hydroxypentyl]amino]-3-naphthalen-1-yl-1-oxopropan-2-yl]carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-[1-[[4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-5-hydroxypentyl]amino]-3-naphthalen-1-yl-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 68649572 |
| Molecular Formula | C31H39F3N4O6S |
| Molecular Weight | 652.74 g/mol |
| Exact Mass | 652.25 |
| IUPAC Name | 2,2,2-trifluoroethyl N-[1-[[4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-5-hydroxypentyl]amino]-3-naphthalen-1-yl-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)CN(C(CO)CCCNC(=O)C(Cc1cccc2ccccc12)NC(=O)OCC(F)(F)F)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C31H39F3N4O6S/c1-21(2)18-38(45(42,43)26-14-12-24(35)13-15-26)25(19-39)10-6-16-36-29(40)28(37-30(41)44-20-31(32,33)34)17-23-9-5-8-22-7-3-4-11-27(22)23/h3-5,7-9,11-15,21,25,28,39H,6,10,16-20,35H2,1-2H3,(H,36,40)(H,37,41) |
| InChIKey | VJFHOFKHUBRMAV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 151.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.74 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|