C30H39N3O6S — CID 18009094
[4-[[1-hydroxy-6-(3-naphthalen-1-ylpropanoylamino)hexan-2-yl]-(2-methylpropyl)sulfamoyl]phenyl] carbamate (PubChem CID 18009094) has the molecular formula C30H39N3O6S and a molecular weight of 569.72 g/mol. Its IUPAC name is [4-[[1-hydroxy-6-(3-naphthalen-1-ylpropanoylamino)hexan-2-yl]-(2-methylpropyl)sulfamoyl]phenyl] carbamate.
| Compound Name | [4-[[1-hydroxy-6-(3-naphthalen-1-ylpropanoylamino)hexan-2-yl]-(2-methylpropyl)sulfamoyl]phenyl] carbamate |
|---|---|
| PubChem CID | 18009094 |
| Molecular Formula | C30H39N3O6S |
| Molecular Weight | 569.72 g/mol |
| Exact Mass | 569.26 |
| IUPAC Name | [4-[[1-hydroxy-6-(3-naphthalen-1-ylpropanoylamino)hexan-2-yl]-(2-methylpropyl)sulfamoyl]phenyl] carbamate |
| SMILES | CC(C)CN(C(CO)CCCCNC(=O)CCc1cccc2ccccc12)S(=O)(=O)c1ccc(OC(N)=O)cc1 |
| InChI | InChI=1S/C30H39N3O6S/c1-22(2)20-33(40(37,38)27-16-14-26(15-17-27)39-30(31)36)25(21-34)11-5-6-19-32-29(35)18-13-24-10-7-9-23-8-3-4-12-28(23)24/h3-4,7-10,12,14-17,22,25,34H,5-6,11,13,18-21H2,1-2H3,(H2,31,36)(H,32,35) |
| InChIKey | QRZFTSPWLGMIMQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 139.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.72 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|