C28H43N3O7S — CID 142084708
N-[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]-3-(2,4-dimethoxyphenyl)propanamide;formaldehyde (PubChem CID 142084708) has the molecular formula C28H43N3O7S and a molecular weight of 565.73 g/mol. Its IUPAC name is N-[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]-3-(2,4-dimethoxyphenyl)propanamide;formaldehyde.
| Compound Name | N-[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]-3-(2,4-dimethoxyphenyl)propanamide;formaldehyde |
|---|---|
| PubChem CID | 142084708 |
| Molecular Formula | C28H43N3O7S |
| Molecular Weight | 565.73 g/mol |
| Exact Mass | 565.28 |
| IUPAC Name | N-[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]-3-(2,4-dimethoxyphenyl)propanamide;formaldehyde |
| SMILES | C=O.COc1ccc(CCC(=O)NCCCC[C@@H](CO)N(CC(C)C)S(=O)(=O)c2ccc(N)cc2)c(OC)c1 |
| InChI | InChI=1S/C27H41N3O6S.CH2O/c1-20(2)18-30(37(33,34)25-13-10-22(28)11-14-25)23(19-31)7-5-6-16-29-27(32)15-9-21-8-12-24(35-3)17-26(21)36-4;1-2/h8,10-14,17,20,23,31H,5-7,9,15-16,18-19,28H2,1-4H3,(H,29,32);1H2/t23-;/m0./s1 |
| InChIKey | WLSRRWDFXWMSSH-BQAIUKQQSA-N |
| XLogP | 3.03 |
| TPSA | 148.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.73 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|