C17H30N2O4S — CID 67531312
N-[(2S)-6-amino-1-hydroxyhexan-2-yl]-4-methoxy-N-(2-methylpropyl)benzenesulfonamide (PubChem CID 67531312) has the molecular formula C17H30N2O4S and a molecular weight of 358.50 g/mol. Its IUPAC name is N-[(2S)-6-amino-1-hydroxyhexan-2-yl]-4-methoxy-N-(2-methylpropyl)benzenesulfonamide.
| Compound Name | N-[(2S)-6-amino-1-hydroxyhexan-2-yl]-4-methoxy-N-(2-methylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 67531312 |
| Molecular Formula | C17H30N2O4S |
| Molecular Weight | 358.50 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | N-[(2S)-6-amino-1-hydroxyhexan-2-yl]-4-methoxy-N-(2-methylpropyl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(C)C)[C@H](CO)CCCCN)cc1 |
| InChI | InChI=1S/C17H30N2O4S/c1-14(2)12-19(15(13-20)6-4-5-11-18)24(21,22)17-9-7-16(23-3)8-10-17/h7-10,14-15,20H,4-6,11-13,18H2,1-3H3/t15-/m0/s1 |
| InChIKey | HLWWJQCFMSSSLF-HNNXBMFYSA-N |
| XLogP | 1.83 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.50 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|