C20H38N3O6PS — CID 66790845
[6-amino-2-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]hexyl] diethyl phosphate (PubChem CID 66790845) has the molecular formula C20H38N3O6PS and a molecular weight of 479.58 g/mol. Its IUPAC name is [6-amino-2-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]hexyl] diethyl phosphate.
| Compound Name | [6-amino-2-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]hexyl] diethyl phosphate |
|---|---|
| PubChem CID | 66790845 |
| Molecular Formula | C20H38N3O6PS |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | [6-amino-2-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]hexyl] diethyl phosphate |
| SMILES | CCOP(=O)(OCC)OCC(CCCCN)N(CC(C)C)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C20H38N3O6PS/c1-5-27-30(24,28-6-2)29-16-19(9-7-8-14-21)23(15-17(3)4)31(25,26)20-12-10-18(22)11-13-20/h10-13,17,19H,5-9,14-16,21-22H2,1-4H3 |
| InChIKey | RIJQIRGRSFUUGK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 134.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|