C18H33N3O2S — CID 20706602
4-amino-N-(6-amino-2,2-dimethylhexyl)-N-(2-methylpropyl)benzenesulfonamide (PubChem CID 20706602) has the molecular formula C18H33N3O2S and a molecular weight of 355.55 g/mol. Its IUPAC name is 4-amino-N-(6-amino-2,2-dimethylhexyl)-N-(2-methylpropyl)benzenesulfonamide.
| Compound Name | 4-amino-N-(6-amino-2,2-dimethylhexyl)-N-(2-methylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 20706602 |
| Molecular Formula | C18H33N3O2S |
| Molecular Weight | 355.55 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 4-amino-N-(6-amino-2,2-dimethylhexyl)-N-(2-methylpropyl)benzenesulfonamide |
| SMILES | CC(C)CN(CC(C)(C)CCCCN)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C18H33N3O2S/c1-15(2)13-21(14-18(3,4)11-5-6-12-19)24(22,23)17-9-7-16(20)8-10-17/h7-10,15H,5-6,11-14,19-20H2,1-4H3 |
| InChIKey | VSWKOAGLNAKEFA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.55 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|