C22H38N2O5S — CID 20706645
propan-2-yl N-[5-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-4,4-dimethylpentyl]carbamate (PubChem CID 20706645) has the molecular formula C22H38N2O5S and a molecular weight of 442.62 g/mol. Its IUPAC name is propan-2-yl N-[5-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-4,4-dimethylpentyl]carbamate.
| Compound Name | propan-2-yl N-[5-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-4,4-dimethylpentyl]carbamate |
|---|---|
| PubChem CID | 20706645 |
| Molecular Formula | C22H38N2O5S |
| Molecular Weight | 442.62 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | propan-2-yl N-[5-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-4,4-dimethylpentyl]carbamate |
| SMILES | COc1ccc(S(=O)(=O)N(CC(C)C)CC(C)(C)CCCNC(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C22H38N2O5S/c1-17(2)15-24(30(26,27)20-11-9-19(28-7)10-12-20)16-22(5,6)13-8-14-23-21(25)29-18(3)4/h9-12,17-18H,8,13-16H2,1-7H3,(H,23,25) |
| InChIKey | NLDLBTZQXZAWFO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.62 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|