C20H34N2O5S — CID 20706656
methyl N-[5-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-4,4-dimethylpentyl]carbamate (PubChem CID 20706656) has the molecular formula C20H34N2O5S and a molecular weight of 414.57 g/mol. Its IUPAC name is methyl N-[5-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-4,4-dimethylpentyl]carbamate.
| Compound Name | methyl N-[5-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-4,4-dimethylpentyl]carbamate |
|---|---|
| PubChem CID | 20706656 |
| Molecular Formula | C20H34N2O5S |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | methyl N-[5-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-4,4-dimethylpentyl]carbamate |
| SMILES | COC(=O)NCCCC(C)(C)CN(CC(C)C)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H34N2O5S/c1-16(2)14-22(15-20(3,4)12-7-13-21-19(23)27-6)28(24,25)18-10-8-17(26-5)9-11-18/h8-11,16H,7,12-15H2,1-6H3,(H,21,23) |
| InChIKey | LPISURZQMVZQNO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|