C25H36BN5O5S — CID 20706692
N-(5-azido-2,2-dimethylpentyl)-N-[2-hydroxy-3-(oxoboranylmethylamino)-4-phenylbutyl]-4-methoxybenzenesulfonamide (PubChem CID 20706692) has the molecular formula C25H36BN5O5S and a molecular weight of 529.47 g/mol. Its IUPAC name is N-(5-azido-2,2-dimethylpentyl)-N-[2-hydroxy-3-(oxoboranylmethylamino)-4-phenylbutyl]-4-methoxybenzenesulfonamide.
| Compound Name | N-(5-azido-2,2-dimethylpentyl)-N-[2-hydroxy-3-(oxoboranylmethylamino)-4-phenylbutyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 20706692 |
| Molecular Formula | C25H36BN5O5S |
| Molecular Weight | 529.47 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | N-(5-azido-2,2-dimethylpentyl)-N-[2-hydroxy-3-(oxoboranylmethylamino)-4-phenylbutyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(O)C(Cc2ccccc2)NCB=O)CC(C)(C)CCCN=[N+]=[N-])cc1 |
| InChI | InChI=1S/C25H36BN5O5S/c1-25(2,14-7-15-29-30-27)18-31(37(34,35)22-12-10-21(36-3)11-13-22)17-24(32)23(28-19-26-33)16-20-8-5-4-6-9-20/h4-6,8-13,23-24,28,32H,7,14-19H2,1-3H3 |
| InChIKey | URLRYNGSMKFVLH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 144.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|