C29H42N5O6S- — CID 57359106
N-[(2S,3R)-4-[(5-azido-2,2-dimethylpentyl)-(4-methoxyphenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]-N-tert-butylcarbamate (PubChem CID 57359106) has the molecular formula C29H42N5O6S- and a molecular weight of 588.75 g/mol. Its IUPAC name is N-[(2S,3R)-4-[(5-azido-2,2-dimethylpentyl)-(4-methoxyphenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]-N-tert-butylcarbamate.
| Compound Name | N-[(2S,3R)-4-[(5-azido-2,2-dimethylpentyl)-(4-methoxyphenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]-N-tert-butylcarbamate |
|---|---|
| PubChem CID | 57359106 |
| Molecular Formula | C29H42N5O6S- |
| Molecular Weight | 588.75 g/mol |
| Exact Mass | 588.29 |
| IUPAC Name | N-[(2S,3R)-4-[(5-azido-2,2-dimethylpentyl)-(4-methoxyphenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]-N-tert-butylcarbamate |
| SMILES | COc1ccc(S(=O)(=O)N(C[C@@H](O)[C@H](Cc2ccccc2)N(C(=O)[O-])C(C)(C)C)CC(C)(C)CCCN=[N+]=[N-])cc1 |
| InChI | InChI=1S/C29H43N5O6S/c1-28(2,3)34(27(36)37)25(19-22-11-8-7-9-12-22)26(35)20-33(21-29(4,5)17-10-18-31-32-30)41(38,39)24-15-13-23(40-6)14-16-24/h7-9,11-16,25-26,35H,10,17-21H2,1-6H3,(H,36,37)/p-1/t25-,26+/m0/s1 |
| InChIKey | BIPDIGGEXGLIPE-IZZNHLLZSA-M |
| XLogP | 4.22 |
| TPSA | 158.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.75 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|