C24H37NO6 — CID 138974783
dipropan-2-yl 2-[5-[(4-methoxybenzoyl)amino]-2,2-dimethylpentyl]propanedioate (PubChem CID 138974783) has the molecular formula C24H37NO6 and a molecular weight of 435.56 g/mol. Its IUPAC name is dipropan-2-yl 2-[5-[(4-methoxybenzoyl)amino]-2,2-dimethylpentyl]propanedioate.
| Compound Name | dipropan-2-yl 2-[5-[(4-methoxybenzoyl)amino]-2,2-dimethylpentyl]propanedioate |
|---|---|
| PubChem CID | 138974783 |
| Molecular Formula | C24H37NO6 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | dipropan-2-yl 2-[5-[(4-methoxybenzoyl)amino]-2,2-dimethylpentyl]propanedioate |
| SMILES | COc1ccc(C(=O)NCCCC(C)(C)CC(C(=O)OC(C)C)C(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C24H37NO6/c1-16(2)30-22(27)20(23(28)31-17(3)4)15-24(5,6)13-8-14-25-21(26)18-9-11-19(29-7)12-10-18/h9-12,16-17,20H,8,13-15H2,1-7H3,(H,25,26) |
| InChIKey | OXLBSAPXKKBHHL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|