C17H33N3O2S — CID 142012161
3-amino-N-(5-amino-2,2-dimethylpentyl)-N-ethylbenzenesulfonamide;ethane (PubChem CID 142012161) has the molecular formula C17H33N3O2S and a molecular weight of 343.54 g/mol. Its IUPAC name is 3-amino-N-(5-amino-2,2-dimethylpentyl)-N-ethylbenzenesulfonamide;ethane.
| Compound Name | 3-amino-N-(5-amino-2,2-dimethylpentyl)-N-ethylbenzenesulfonamide;ethane |
|---|---|
| PubChem CID | 142012161 |
| Molecular Formula | C17H33N3O2S |
| Molecular Weight | 343.54 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 3-amino-N-(5-amino-2,2-dimethylpentyl)-N-ethylbenzenesulfonamide;ethane |
| SMILES | CC.CCN(CC(C)(C)CCCN)S(=O)(=O)c1cccc(N)c1 |
| InChI | InChI=1S/C15H27N3O2S.C2H6/c1-4-18(12-15(2,3)9-6-10-16)21(19,20)14-8-5-7-13(17)11-14;1-2/h5,7-8,11H,4,6,9-10,12,16-17H2,1-3H3;1-2H3 |
| InChIKey | GWIXYQYVKWBBNS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.54 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|