About 3-amino-N-(5-amino-2,2-dimethylpentyl)-N-ethylbenzenesulfonamide;ethane
3-amino-N-(5-amino-2,2-dimethylpentyl)-N-ethylbenzenesulfonamide;ethane (PubChem CID 142012161) has the molecular formula C17H33N3O2S
and a molecular weight of 343.54 g/mol. Its IUPAC name is 3-amino-N-(5-amino-2,2-dimethylpentyl)-N-ethylbenzenesulfonamide;ethane.
Molecular Properties
| Compound Name | 3-amino-N-(5-amino-2,2-dimethylpentyl)-N-ethylbenzenesulfonamide;ethane |
| PubChem CID | 142012161 |
| Molecular Formula | C17H33N3O2S |
| Molecular Weight | 343.54 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 3-amino-N-(5-amino-2,2-dimethylpentyl)-N-ethylbenzenesulfonamide;ethane |
| SMILES | CC.CCN(CC(C)(C)CCCN)S(=O)(=O)c1cccc(N)c1 |
| InChI | InChI=1S/C15H27N3O2S.C2H6/c1-4-18(12-15(2,3)9-6-10-16)21(19,20)14-8-5-7-13(17)11-14;1-2/h5,7-8,11H,4,6,9-10,12,16-17H2,1-3H3;1-2H3 |
| InChIKey | GWIXYQYVKWBBNS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.54 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-N-(5-amino-2,2-dimethylpentyl)-N-ethylbenzenesulfonamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-(5-amino-2,2-dimethylpentyl)-N-ethylbenzenesulfonamide;ethane?
The IUPAC name of 3-amino-N-(5-amino-2,2-dimethylpentyl)-N-ethylbenzenesulfonamide;ethane (CID 142012161) is 3-amino-N-(5-amino-2,2-dimethylpentyl)-N-ethylbenzenesulfonamide;ethane.
What is the SMILES notation for 3-amino-N-(5-amino-2,2-dimethylpentyl)-N-ethylbenzenesulfonamide;ethane?
The canonical SMILES for 3-amino-N-(5-amino-2,2-dimethylpentyl)-N-ethylbenzenesulfonamide;ethane is CC.CCN(CC(C)(C)CCCN)S(=O)(=O)c1cccc(N)c1.
What is the InChIKey of 3-amino-N-(5-amino-2,2-dimethylpentyl)-N-ethylbenzenesulfonamide;ethane?
The InChIKey is GWIXYQYVKWBBNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27N3O2S.C2H6/c1-4-18(12-15(2,3)9-6-10-16)21(19,20)14-8-5-7-13(17)11-14;1-2/h5,7-8,11H,4,6,9-10,12,16-17H2,1-3H3;1-2H3.
What are the key properties of 3-amino-N-(5-amino-2,2-dimethylpentyl)-N-ethylbenzenesulfonamide;ethane?
3-amino-N-(5-amino-2,2-dimethylpentyl)-N-ethylbenzenesulfonamide;ethane has a molecular weight of 343.54 g/mol, XLogP of 3.07, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-(5-amino-2,2-dimethylpentyl)-N-ethylbenzenesulfonamide;ethane is sourced from PubChem (CID 142012161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).