C20H35NO4S — CID 142012104
N-(2,2-dimethylheptyl)-N-ethyl-1,3-benzodioxole-5-sulfonamide;ethane (PubChem CID 142012104) has the molecular formula C20H35NO4S and a molecular weight of 385.57 g/mol. Its IUPAC name is N-(2,2-dimethylheptyl)-N-ethyl-1,3-benzodioxole-5-sulfonamide;ethane.
| Compound Name | N-(2,2-dimethylheptyl)-N-ethyl-1,3-benzodioxole-5-sulfonamide;ethane |
|---|---|
| PubChem CID | 142012104 |
| Molecular Formula | C20H35NO4S |
| Molecular Weight | 385.57 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | N-(2,2-dimethylheptyl)-N-ethyl-1,3-benzodioxole-5-sulfonamide;ethane |
| SMILES | CC.CCCCCC(C)(C)CN(CC)S(=O)(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H29NO4S.C2H6/c1-5-7-8-11-18(3,4)13-19(6-2)24(20,21)15-9-10-16-17(12-15)23-14-22-16;1-2/h9-10,12H,5-8,11,13-14H2,1-4H3;1-2H3 |
| InChIKey | UGCOPWUPGFHGPT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.57 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|