C30H43ClN2O7S — CID 67092321
tert-butyl N-[(2S,3S)-4-[1,3-benzodioxol-5-ylsulfonyl-(6-chloro-2,2-dimethylhexyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 67092321) has the molecular formula C30H43ClN2O7S and a molecular weight of 611.20 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S)-4-[1,3-benzodioxol-5-ylsulfonyl-(6-chloro-2,2-dimethylhexyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3S)-4-[1,3-benzodioxol-5-ylsulfonyl-(6-chloro-2,2-dimethylhexyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 67092321 |
| Molecular Formula | C30H43ClN2O7S |
| Molecular Weight | 611.20 g/mol |
| Exact Mass | 610.25 |
| IUPAC Name | tert-butyl N-[(2S,3S)-4-[1,3-benzodioxol-5-ylsulfonyl-(6-chloro-2,2-dimethylhexyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | CC(C)(CCCCCl)CN(C[C@H](O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C)S(=O)(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C30H43ClN2O7S/c1-29(2,3)40-28(35)32-24(17-22-11-7-6-8-12-22)25(34)19-33(20-30(4,5)15-9-10-16-31)41(36,37)23-13-14-26-27(18-23)39-21-38-26/h6-8,11-14,18,24-25,34H,9-10,15-17,19-21H2,1-5H3,(H,32,35)/t24-,25-/m0/s1 |
| InChIKey | JHMPTAJUEDAEIY-DQEYMECFSA-N |
| XLogP | 5.34 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.20 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|