C35H43N5O8S — CID 87781338
[(2S,3S)-4-[1,3-benzodioxol-5-ylsulfonyl-[7-[[(cyanoamino)-phenoxymethylidene]amino]-2,2-dimethylheptyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamic acid (PubChem CID 87781338) has the molecular formula C35H43N5O8S and a molecular weight of 693.82 g/mol. Its IUPAC name is [(2S,3S)-4-[1,3-benzodioxol-5-ylsulfonyl-[7-[[(cyanoamino)-phenoxymethylidene]amino]-2,2-dimethylheptyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamic acid.
| Compound Name | [(2S,3S)-4-[1,3-benzodioxol-5-ylsulfonyl-[7-[[(cyanoamino)-phenoxymethylidene]amino]-2,2-dimethylheptyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 87781338 |
| Molecular Formula | C35H43N5O8S |
| Molecular Weight | 693.82 g/mol |
| Exact Mass | 693.28 |
| IUPAC Name | [(2S,3S)-4-[1,3-benzodioxol-5-ylsulfonyl-[7-[[(cyanoamino)-phenoxymethylidene]amino]-2,2-dimethylheptyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamic acid |
| SMILES | CC(C)(CCCCC/N=C(\NC#N)Oc1ccccc1)CN(C[C@H](O)[C@H](Cc1ccccc1)NC(=O)O)S(=O)(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C35H43N5O8S/c1-35(2,18-10-5-11-19-37-33(38-24-36)48-27-14-8-4-9-15-27)23-40(49(44,45)28-16-17-31-32(21-28)47-25-46-31)22-30(41)29(39-34(42)43)20-26-12-6-3-7-13-26/h3-4,6-9,12-17,21,29-30,39,41H,5,10-11,18-20,22-23,25H2,1-2H3,(H,37,38)(H,42,43)/t29-,30-/m0/s1 |
| InChIKey | BWGKPAZIXRFDFN-KYJUHHDHSA-N |
| XLogP | 4.74 |
| TPSA | 182.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.82 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|