C36H58N2O8SSi — CID 21356827
tert-butyl N-[(2S,3R)-4-[1,3-benzodioxol-5-ylsulfonyl-[6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhexyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 21356827) has the molecular formula C36H58N2O8SSi and a molecular weight of 707.02 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-4-[1,3-benzodioxol-5-ylsulfonyl-[6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhexyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R)-4-[1,3-benzodioxol-5-ylsulfonyl-[6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhexyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 21356827 |
| Molecular Formula | C36H58N2O8SSi |
| Molecular Weight | 707.02 g/mol |
| Exact Mass | 706.37 |
| IUPAC Name | tert-butyl N-[(2S,3R)-4-[1,3-benzodioxol-5-ylsulfonyl-[6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhexyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | CC(C)(CCCCO[Si](C)(C)C(C)(C)C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C)S(=O)(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C36H58N2O8SSi/c1-34(2,3)46-33(40)37-29(22-27-16-12-11-13-17-27)30(39)24-38(47(41,42)28-18-19-31-32(23-28)44-26-43-31)25-36(7,8)20-14-15-21-45-48(9,10)35(4,5)6/h11-13,16-19,23,29-30,39H,14-15,20-22,24-26H2,1-10H3,(H,37,40)/t29-,30+/m0/s1 |
| InChIKey | CMTVWYIBDVOART-XZWHSSHBSA-N |
| XLogP | 7.12 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.02 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|