C16H28ClN3O3S — CID 18009008
4-amino-N-(6-amino-1-hydroxyhexan-2-yl)-3-chloro-N-(2-methylpropyl)benzenesulfonamide (PubChem CID 18009008) has the molecular formula C16H28ClN3O3S and a molecular weight of 377.94 g/mol. Its IUPAC name is 4-amino-N-(6-amino-1-hydroxyhexan-2-yl)-3-chloro-N-(2-methylpropyl)benzenesulfonamide.
| Compound Name | 4-amino-N-(6-amino-1-hydroxyhexan-2-yl)-3-chloro-N-(2-methylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 18009008 |
| Molecular Formula | C16H28ClN3O3S |
| Molecular Weight | 377.94 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 4-amino-N-(6-amino-1-hydroxyhexan-2-yl)-3-chloro-N-(2-methylpropyl)benzenesulfonamide |
| SMILES | CC(C)CN(C(CO)CCCCN)S(=O)(=O)c1ccc(N)c(Cl)c1 |
| InChI | InChI=1S/C16H28ClN3O3S/c1-12(2)10-20(13(11-21)5-3-4-8-18)24(22,23)14-6-7-16(19)15(17)9-14/h6-7,9,12-13,21H,3-5,8,10-11,18-19H2,1-2H3 |
| InChIKey | NOZZLRBYJUTQFK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.94 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|