C17H28N2O3S — CID 59412122
N-[(3S)-7-amino-2-oxoheptan-3-yl]-N-(2-methylpropyl)benzenesulfonamide (PubChem CID 59412122) has the molecular formula C17H28N2O3S and a molecular weight of 340.49 g/mol. Its IUPAC name is N-[(3S)-7-amino-2-oxoheptan-3-yl]-N-(2-methylpropyl)benzenesulfonamide.
| Compound Name | N-[(3S)-7-amino-2-oxoheptan-3-yl]-N-(2-methylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 59412122 |
| Molecular Formula | C17H28N2O3S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | N-[(3S)-7-amino-2-oxoheptan-3-yl]-N-(2-methylpropyl)benzenesulfonamide |
| SMILES | CC(=O)[C@H](CCCCN)N(CC(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H28N2O3S/c1-14(2)13-19(17(15(3)20)11-7-8-12-18)23(21,22)16-9-5-4-6-10-16/h4-6,9-10,14,17H,7-8,11-13,18H2,1-3H3/t17-/m0/s1 |
| InChIKey | ZQQIOJHFTXJZRS-KRWDZBQOSA-N |
| XLogP | 2.42 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|