C24H32AsClN2O4S — CID 87589796
CID 87589796 (PubChem CID 87589796) has the molecular formula C24H32AsClN2O4S and a molecular weight of 554.97 g/mol.
| Compound Name | CID 87589796 |
|---|---|
| PubChem CID | 87589796 |
| Molecular Formula | C24H32AsClN2O4S |
| Molecular Weight | 554.97 g/mol |
| Exact Mass | 554.10 |
| IUPAC Name | — |
| SMILES | CC(C)CN(C(CO)CCCC(C)(C(N)=O)c1ccccc1Cl)S(=O)(=O)c1ccc([As])cc1 |
| InChI | InChI=1S/C24H32AsClN2O4S/c1-17(2)15-28(33(31,32)20-12-10-18(25)11-13-20)19(16-29)7-6-14-24(3,23(27)30)21-8-4-5-9-22(21)26/h4-5,8-13,17,19,29H,6-7,14-16H2,1-3H3,(H2,27,30) |
| InChIKey | JWAFVSOHSUEZCL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.97 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|