About CID 87589796
CID 87589796 (PubChem CID 87589796) has the molecular formula C24H32AsClN2O4S
and a molecular weight of 554.97 g/mol.
Molecular Properties
| Compound Name | CID 87589796 |
| PubChem CID | 87589796 |
| Molecular Formula | C24H32AsClN2O4S |
| Molecular Weight | 554.97 g/mol |
| Exact Mass | 554.10 |
| IUPAC Name | — |
| SMILES | CC(C)CN(C(CO)CCCC(C)(C(N)=O)c1ccccc1Cl)S(=O)(=O)c1ccc([As])cc1 |
| InChI | InChI=1S/C24H32AsClN2O4S/c1-17(2)15-28(33(31,32)20-12-10-18(25)11-13-20)19(16-29)7-6-14-24(3,23(27)30)21-8-4-5-9-22(21)26/h4-5,8-13,17,19,29H,6-7,14-16H2,1-3H3,(H2,27,30) |
| InChIKey | JWAFVSOHSUEZCL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 554.97 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87589796 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87589796?
The IUPAC name of CID 87589796 (CID 87589796) is not available.
What is the SMILES notation for CID 87589796?
The canonical SMILES for CID 87589796 is CC(C)CN(C(CO)CCCC(C)(C(N)=O)c1ccccc1Cl)S(=O)(=O)c1ccc([As])cc1.
What is the InChIKey of CID 87589796?
The InChIKey is JWAFVSOHSUEZCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H32AsClN2O4S/c1-17(2)15-28(33(31,32)20-12-10-18(25)11-13-20)19(16-29)7-6-14-24(3,23(27)30)21-8-4-5-9-22(21)26/h4-5,8-13,17,19,29H,6-7,14-16H2,1-3H3,(H2,27,30).
What are the key properties of CID 87589796?
CID 87589796 has a molecular weight of 554.97 g/mol, XLogP of 2.75, 12 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87589796 is sourced from PubChem (CID 87589796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).