C36H50N4O6S — CID 15958360
tert-butyl N-[(2S)-1-[[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]carbamate (PubChem CID 15958360) has the molecular formula C36H50N4O6S and a molecular weight of 666.89 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 15958360 |
| Molecular Formula | C36H50N4O6S |
| Molecular Weight | 666.89 g/mol |
| Exact Mass | 666.35 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]carbamate |
| SMILES | CC(C)CN([C@H](CO)CCCCNC(=O)[C@@H](NC(=O)OC(C)(C)C)C(c1ccccc1)c1ccccc1)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C36H50N4O6S/c1-26(2)24-40(47(44,45)31-21-19-29(37)20-22-31)30(25-41)18-12-13-23-38-34(42)33(39-35(43)46-36(3,4)5)32(27-14-8-6-9-15-27)28-16-10-7-11-17-28/h6-11,14-17,19-22,26,30,32-33,41H,12-13,18,23-25,37H2,1-5H3,(H,38,42)(H,39,43)/t30-,33-/m0/s1 |
| InChIKey | RIZQZYAOEOUMIE-DITALETJSA-N |
| XLogP | 5.29 |
| TPSA | 151.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.89 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|