C34H47N4O9PS — CID 69255103
ethyl N-[(2S)-1-[[5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-phosphonooxyhexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]carbamate (PubChem CID 69255103) has the molecular formula C34H47N4O9PS and a molecular weight of 718.81 g/mol. Its IUPAC name is ethyl N-[(2S)-1-[[5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-phosphonooxyhexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]carbamate.
| Compound Name | ethyl N-[(2S)-1-[[5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-phosphonooxyhexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 69255103 |
| Molecular Formula | C34H47N4O9PS |
| Molecular Weight | 718.81 g/mol |
| Exact Mass | 718.28 |
| IUPAC Name | ethyl N-[(2S)-1-[[5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-phosphonooxyhexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]carbamate |
| SMILES | CCOC(=O)N[C@H](C(=O)NCCCCC(COP(=O)(O)O)N(CC(C)C)S(=O)(=O)c1ccc(N)cc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H47N4O9PS/c1-4-46-34(40)37-32(31(26-13-7-5-8-14-26)27-15-9-6-10-16-27)33(39)36-22-12-11-17-29(24-47-48(41,42)43)38(23-25(2)3)49(44,45)30-20-18-28(35)19-21-30/h5-10,13-16,18-21,25,29,31-32H,4,11-12,17,22-24,35H2,1-3H3,(H,36,39)(H,37,40)(H2,41,42,43)/t29?,32-/m0/s1 |
| InChIKey | DKCJNVFZRRMECQ-VQSVVBPOSA-N |
| XLogP | 4.63 |
| TPSA | 197.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.81 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|