C27H40FN4O9PS — CID 89461077
methyl N-[(2S)-1-[[5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-phosphonooxyhexyl]amino]-3-(2-fluorophenyl)-1-oxopropan-2-yl]carbamate (PubChem CID 89461077) has the molecular formula C27H40FN4O9PS and a molecular weight of 646.68 g/mol. Its IUPAC name is methyl N-[(2S)-1-[[5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-phosphonooxyhexyl]amino]-3-(2-fluorophenyl)-1-oxopropan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-1-[[5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-phosphonooxyhexyl]amino]-3-(2-fluorophenyl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 89461077 |
| Molecular Formula | C27H40FN4O9PS |
| Molecular Weight | 646.68 g/mol |
| Exact Mass | 646.22 |
| IUPAC Name | methyl N-[(2S)-1-[[5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-phosphonooxyhexyl]amino]-3-(2-fluorophenyl)-1-oxopropan-2-yl]carbamate |
| SMILES | COC(=O)N[C@@H](Cc1ccccc1F)C(=O)NCCCCC(COP(=O)(O)O)N(CC(C)C)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C27H40FN4O9PS/c1-19(2)17-32(43(38,39)23-13-11-21(29)12-14-23)22(18-41-42(35,36)37)9-6-7-15-30-26(33)25(31-27(34)40-3)16-20-8-4-5-10-24(20)28/h4-5,8,10-14,19,22,25H,6-7,9,15-18,29H2,1-3H3,(H,30,33)(H,31,34)(H2,35,36,37)/t22?,25-/m0/s1 |
| InChIKey | YBOZVKXWINZRED-TUXUZCGSSA-N |
| XLogP | 2.79 |
| TPSA | 197.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.68 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|