C32H43N5O5S — CID 59412103
N-[(2S)-1-[[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-3-(2-methylphenyl)-1-oxopropan-2-yl]pyridine-3-carboxamide (PubChem CID 59412103) has the molecular formula C32H43N5O5S and a molecular weight of 609.79 g/mol. Its IUPAC name is N-[(2S)-1-[[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-3-(2-methylphenyl)-1-oxopropan-2-yl]pyridine-3-carboxamide.
| Compound Name | N-[(2S)-1-[[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-3-(2-methylphenyl)-1-oxopropan-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 59412103 |
| Molecular Formula | C32H43N5O5S |
| Molecular Weight | 609.79 g/mol |
| Exact Mass | 609.30 |
| IUPAC Name | N-[(2S)-1-[[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-3-(2-methylphenyl)-1-oxopropan-2-yl]pyridine-3-carboxamide |
| SMILES | Cc1ccccc1C[C@H](NC(=O)c1cccnc1)C(=O)NCCCC[C@@H](CO)N(CC(C)C)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C32H43N5O5S/c1-23(2)21-37(43(41,42)29-15-13-27(33)14-16-29)28(22-38)12-6-7-18-35-32(40)30(19-25-10-5-4-9-24(25)3)36-31(39)26-11-8-17-34-20-26/h4-5,8-11,13-17,20,23,28,30,38H,6-7,12,18-19,21-22,33H2,1-3H3,(H,35,40)(H,36,39)/t28-,30-/m0/s1 |
| InChIKey | QBJVVXFVLNRMMD-JDXGNMNLSA-N |
| XLogP | 3.31 |
| TPSA | 154.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.79 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|