C32H43N5O5S — CID 70293386
N-[(2S)-1-[[5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-5-hydroxypentyl]amino]-3-(2-methylphenyl)-1-oxopropan-2-yl]-6-methylpyridine-3-carboxamide (PubChem CID 70293386) has the molecular formula C32H43N5O5S and a molecular weight of 609.79 g/mol. Its IUPAC name is N-[(2S)-1-[[5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-5-hydroxypentyl]amino]-3-(2-methylphenyl)-1-oxopropan-2-yl]-6-methylpyridine-3-carboxamide.
| Compound Name | N-[(2S)-1-[[5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-5-hydroxypentyl]amino]-3-(2-methylphenyl)-1-oxopropan-2-yl]-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 70293386 |
| Molecular Formula | C32H43N5O5S |
| Molecular Weight | 609.79 g/mol |
| Exact Mass | 609.30 |
| IUPAC Name | N-[(2S)-1-[[5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-5-hydroxypentyl]amino]-3-(2-methylphenyl)-1-oxopropan-2-yl]-6-methylpyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)N[C@@H](Cc2ccccc2C)C(=O)NCCCCC(O)N(CC(C)C)S(=O)(=O)c2ccc(N)cc2)cn1 |
| InChI | InChI=1S/C32H43N5O5S/c1-22(2)21-37(43(41,42)28-16-14-27(33)15-17-28)30(38)11-7-8-18-34-32(40)29(19-25-10-6-5-9-23(25)3)36-31(39)26-13-12-24(4)35-20-26/h5-6,9-10,12-17,20,22,29-30,38H,7-8,11,18-19,21,33H2,1-4H3,(H,34,40)(H,36,39)/t29-,30?/m0/s1 |
| InChIKey | AAOFGOWIPPBFNM-UFXYQILXSA-N |
| XLogP | 3.57 |
| TPSA | 154.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.79 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|